C4H13Cl3O4Si4 — CID 123557269
2,2,4-trichloro-4,6,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 123557269) has the molecular formula C4H13Cl3O4Si4 and a molecular weight of 343.85 g/mol. Its IUPAC name is 2,2,4-trichloro-4,6,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,2,4-trichloro-4,6,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 123557269 |
| Molecular Formula | C4H13Cl3O4Si4 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 341.90 |
| IUPAC Name | 2,2,4-trichloro-4,6,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[SiH]1O[Si](C)(C)O[Si](C)(Cl)O[Si](Cl)(Cl)O1 |
| InChI | InChI=1S/C4H13Cl3O4Si4/c1-12-8-13(2,3)10-14(4,5)11-15(6,7)9-12/h12H,1-4H3 |
| InChIKey | LXSNALGZZUPIJQ-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|