C7H22N2O3Si3 — CID 155623501
2-N,2-N,4-N,4-N,2,4,6-heptamethyl-1,3,5,2,4,6-trioxatrisilinane-2,4-diamine (PubChem CID 155623501) has the molecular formula C7H22N2O3Si3 and a molecular weight of 266.52 g/mol. Its IUPAC name is 2-N,2-N,4-N,4-N,2,4,6-heptamethyl-1,3,5,2,4,6-trioxatrisilinane-2,4-diamine.
| Compound Name | 2-N,2-N,4-N,4-N,2,4,6-heptamethyl-1,3,5,2,4,6-trioxatrisilinane-2,4-diamine |
|---|---|
| PubChem CID | 155623501 |
| Molecular Formula | C7H22N2O3Si3 |
| Molecular Weight | 266.52 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 2-N,2-N,4-N,4-N,2,4,6-heptamethyl-1,3,5,2,4,6-trioxatrisilinane-2,4-diamine |
| SMILES | CN(C)[Si]1(C)O[SiH](C)O[Si](C)(N(C)C)O1 |
| InChI | InChI=1S/C7H22N2O3Si3/c1-8(2)14(6)10-13(5)11-15(7,12-14)9(3)4/h13H,1-7H3 |
| InChIKey | JPOQDEVSFGBRNS-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.52 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|