C13H25F9O4Si4 — CID 162030705
2,4,6,8-tetramethyl-2,4,6-tris(3,3,3-trifluoropropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 162030705) has the molecular formula C13H25F9O4Si4 and a molecular weight of 528.67 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-2,4,6-tris(3,3,3-trifluoropropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetramethyl-2,4,6-tris(3,3,3-trifluoropropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 162030705 |
| Molecular Formula | C13H25F9O4Si4 |
| Molecular Weight | 528.67 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | 2,4,6,8-tetramethyl-2,4,6-tris(3,3,3-trifluoropropyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C[SiH]1O[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O[Si](C)(CCC(F)(F)F)O1 |
| InChI | InChI=1S/C13H25F9O4Si4/c1-27-23-28(2,8-5-11(14,15)16)25-30(4,10-7-13(20,21)22)26-29(3,24-27)9-6-12(17,18)19/h27H,5-10H2,1-4H3 |
| InChIKey | YVZGIKLJEXQBMQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.67 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|