C12H21F9O3Si3 — CID 123536988
2,2,4-tris(4,4,4-trifluorobutyl)-1,3,5,2,4,6-trioxatrisilinane (PubChem CID 123536988) has the molecular formula C12H21F9O3Si3 and a molecular weight of 468.54 g/mol. Its IUPAC name is 2,2,4-tris(4,4,4-trifluorobutyl)-1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2,2,4-tris(4,4,4-trifluorobutyl)-1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 123536988 |
| Molecular Formula | C12H21F9O3Si3 |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.07 |
| IUPAC Name | 2,2,4-tris(4,4,4-trifluorobutyl)-1,3,5,2,4,6-trioxatrisilinane |
| SMILES | FC(F)(F)CCC[SiH]1O[SiH2]O[Si](CCCC(F)(F)F)(CCCC(F)(F)F)O1 |
| InChI | InChI=1S/C12H21F9O3Si3/c13-10(14,15)4-1-7-26-22-25-23-27(24-26,8-2-5-11(16,17)18)9-3-6-12(19,20)21/h26H,1-9,25H2 |
| InChIKey | DJGKRTLYAAFAGN-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|