C6H22O5Si5 — CID 176847521
2,2,4,6,8,10-hexamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 176847521) has the molecular formula C6H22O5Si5 and a molecular weight of 314.67 g/mol. Its IUPAC name is 2,2,4,6,8,10-hexamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,2,4,6,8,10-hexamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 176847521 |
| Molecular Formula | C6H22O5Si5 |
| Molecular Weight | 314.67 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | 2,2,4,6,8,10-hexamethyl-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | C[SiH]1O[SiH](C)O[SiH](C)O[Si](C)(C)O[SiH](C)O1 |
| InChI | InChI=1S/C6H22O5Si5/c1-12-7-13(2)9-15(4)11-16(5,6)10-14(3)8-12/h12-15H,1-6H3 |
| InChIKey | ZMGJSSHYJCTOBO-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.67 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|