C11H32O7Si5 — CID 169041086
2,4,6,8,10-pentamethyl-2,6-di(propan-2-yloxy)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane (PubChem CID 169041086) has the molecular formula C11H32O7Si5 and a molecular weight of 416.80 g/mol. Its IUPAC name is 2,4,6,8,10-pentamethyl-2,6-di(propan-2-yloxy)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane.
| Compound Name | 2,4,6,8,10-pentamethyl-2,6-di(propan-2-yloxy)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
|---|---|
| PubChem CID | 169041086 |
| Molecular Formula | C11H32O7Si5 |
| Molecular Weight | 416.80 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | 2,4,6,8,10-pentamethyl-2,6-di(propan-2-yloxy)-1,3,5,7,9,2,4,6,8,10-pentaoxapentasilecane |
| SMILES | CC(C)O[Si]1(C)O[SiH](C)O[SiH](C)O[Si](C)(OC(C)C)O[SiH](C)O1 |
| InChI | InChI=1S/C11H32O7Si5/c1-10(2)12-22(8)15-19(5)14-20(6)16-23(9,13-11(3)4)18-21(7)17-22/h10-11,19-21H,1-9H3 |
| InChIKey | IMPBNLLZSOMKAH-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.80 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|