C7H23NO4Si4 — CID 175161540
2,4,6,8-tetramethyl-4-propan-2-yl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine (PubChem CID 175161540) has the molecular formula C7H23NO4Si4 and a molecular weight of 297.61 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-4-propan-2-yl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine.
| Compound Name | 2,4,6,8-tetramethyl-4-propan-2-yl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine |
|---|---|
| PubChem CID | 175161540 |
| Molecular Formula | C7H23NO4Si4 |
| Molecular Weight | 297.61 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | 2,4,6,8-tetramethyl-4-propan-2-yl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-amine |
| SMILES | CC(C)[Si]1(C)O[SiH](C)O[SiH](C)O[Si](C)(N)O1 |
| InChI | InChI=1S/C7H23NO4Si4/c1-7(2)15(5)10-13(3)9-14(4)11-16(6,8)12-15/h7,13-14H,8H2,1-6H3 |
| InChIKey | RZKPCCXDJSTYAD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.61 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|