C7H22O5Si4 — CID 172754372
2,4,6,8-tetramethyl-2-propan-2-yloxy-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 172754372) has the molecular formula C7H22O5Si4 and a molecular weight of 298.59 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-2-propan-2-yloxy-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetramethyl-2-propan-2-yloxy-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 172754372 |
| Molecular Formula | C7H22O5Si4 |
| Molecular Weight | 298.59 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2,4,6,8-tetramethyl-2-propan-2-yloxy-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CC(C)O[Si]1(C)O[SiH](C)O[SiH](C)O[SiH](C)O1 |
| InChI | InChI=1S/C7H22O5Si4/c1-7(2)8-16(6)11-14(4)9-13(3)10-15(5)12-16/h7,13-15H,1-6H3 |
| InChIKey | KUURNABQLVFHQV-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.59 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|