C10H26Cl2O4Si4 — CID 54569917
2,6-dichloro-2,4,6,8-tetramethyl-4,8-dipropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 54569917) has the molecular formula C10H26Cl2O4Si4 and a molecular weight of 393.56 g/mol. Its IUPAC name is 2,6-dichloro-2,4,6,8-tetramethyl-4,8-dipropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,6-dichloro-2,4,6,8-tetramethyl-4,8-dipropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 54569917 |
| Molecular Formula | C10H26Cl2O4Si4 |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 2,6-dichloro-2,4,6,8-tetramethyl-4,8-dipropyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CCC[Si]1(C)O[Si](C)(Cl)O[Si](C)(CCC)O[Si](C)(Cl)O1 |
| InChI | InChI=1S/C10H26Cl2O4Si4/c1-7-9-17(3)13-19(5,11)15-18(4,10-8-2)16-20(6,12)14-17/h7-10H2,1-6H3 |
| InChIKey | ZWNFKGOOLGECBK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|