C31H70O4Si4 — CID 58021544
2,4,6,8-tetramethyl-2,4,6-trioctyl-8-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 58021544) has the molecular formula C31H70O4Si4 and a molecular weight of 619.24 g/mol. Its IUPAC name is 2,4,6,8-tetramethyl-2,4,6-trioctyl-8-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetramethyl-2,4,6-trioctyl-8-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 58021544 |
| Molecular Formula | C31H70O4Si4 |
| Molecular Weight | 619.24 g/mol |
| Exact Mass | 618.44 |
| IUPAC Name | 2,4,6,8-tetramethyl-2,4,6-trioctyl-8-propyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CCCCCCCC[Si]1(C)O[Si](C)(CCC)O[Si](C)(CCCCCCCC)O[Si](C)(CCCCCCCC)O1 |
| InChI | InChI=1S/C31H70O4Si4/c1-9-13-16-19-22-25-29-37(6)32-36(5,28-12-4)33-38(7,30-26-23-20-17-14-10-2)35-39(8,34-37)31-27-24-21-18-15-11-3/h9-31H2,1-8H3 |
| InChIKey | DPHJRWYUQSSGDX-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.24 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|