C15H42O3Si6 — CID 151057276
2-[4,6-bis(2-dimethylsilylethyl)-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl]ethyl-dimethylsilane (PubChem CID 151057276) has the molecular formula C15H42O3Si6 and a molecular weight of 439.01 g/mol. Its IUPAC name is 2-[4,6-bis(2-dimethylsilylethyl)-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl]ethyl-dimethylsilane.
| Compound Name | 2-[4,6-bis(2-dimethylsilylethyl)-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl]ethyl-dimethylsilane |
|---|---|
| PubChem CID | 151057276 |
| Molecular Formula | C15H42O3Si6 |
| Molecular Weight | 439.01 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | 2-[4,6-bis(2-dimethylsilylethyl)-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl]ethyl-dimethylsilane |
| SMILES | C[SiH](C)CC[Si]1(C)O[Si](C)(CC[SiH](C)C)O[Si](C)(CC[SiH](C)C)O1 |
| InChI | InChI=1S/C15H42O3Si6/c1-19(2)10-13-22(7)16-23(8,14-11-20(3)4)18-24(9,17-22)15-12-21(5)6/h19-21H,10-15H2,1-9H3 |
| InChIKey | MFKFSXXWGXFOGC-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.01 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|