C15H40O3Si6 — CID 153439485
1-[4-(1-dimethylsilylethenyl)-6-(2-dimethylsilylethyl)-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl]ethyl-dimethylsilane (PubChem CID 153439485) has the molecular formula C15H40O3Si6 and a molecular weight of 437.00 g/mol. Its IUPAC name is 1-[4-(1-dimethylsilylethenyl)-6-(2-dimethylsilylethyl)-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl]ethyl-dimethylsilane.
| Compound Name | 1-[4-(1-dimethylsilylethenyl)-6-(2-dimethylsilylethyl)-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl]ethyl-dimethylsilane |
|---|---|
| PubChem CID | 153439485 |
| Molecular Formula | C15H40O3Si6 |
| Molecular Weight | 437.00 g/mol |
| Exact Mass | 436.16 |
| IUPAC Name | 1-[4-(1-dimethylsilylethenyl)-6-(2-dimethylsilylethyl)-2,4,6-trimethyl-1,3,5,2,4,6-trioxatrisilinan-2-yl]ethyl-dimethylsilane |
| SMILES | C=C([SiH](C)C)[Si]1(C)O[Si](C)(CC[SiH](C)C)O[Si](C)(C(C)[SiH](C)C)O1 |
| InChI | InChI=1S/C15H40O3Si6/c1-14(20(5)6)23(10)16-22(9,13-12-19(3)4)17-24(11,18-23)15(2)21(7)8/h15,19-21H,1,12-13H2,2-11H3 |
| InChIKey | HUQDFTZBLLKVPF-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.00 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|