About 2-dimethylsilylethanol
2-dimethylsilylethanol (PubChem CID 71371342) has the molecular formula C4H12OSi
and a molecular weight of 104.22 g/mol. Its IUPAC name is 2-dimethylsilylethanol.
Molecular Properties
| Compound Name | 2-dimethylsilylethanol |
| PubChem CID | 71371342 |
| Molecular Formula | C4H12OSi |
| Molecular Weight | 104.22 g/mol |
| Exact Mass | 104.07 |
| IUPAC Name | 2-dimethylsilylethanol |
| SMILES | C[SiH](C)CCO |
| InChI | InChI=1S/C4H12OSi/c1-6(2)4-3-5/h5-6H,3-4H2,1-2H3 |
| InChIKey | LAVHKZDLZXXBTC-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.22 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-dimethylsilylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dimethylsilylethanol?
The IUPAC name of 2-dimethylsilylethanol (CID 71371342) is 2-dimethylsilylethanol.
What is the SMILES notation for 2-dimethylsilylethanol?
The canonical SMILES for 2-dimethylsilylethanol is C[SiH](C)CCO.
What is the InChIKey of 2-dimethylsilylethanol?
The InChIKey is LAVHKZDLZXXBTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H12OSi/c1-6(2)4-3-5/h5-6H,3-4H2,1-2H3.
What are the key properties of 2-dimethylsilylethanol?
2-dimethylsilylethanol has a molecular weight of 104.22 g/mol, XLogP of 0.47, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dimethylsilylethanol is sourced from PubChem (CID 71371342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).