C10H21N — CID 135230946
4,6-dimethyl-5-methylideneheptan-1-amine (PubChem CID 135230946) has the molecular formula C10H21N and a molecular weight of 155.28 g/mol. Its IUPAC name is 4,6-dimethyl-5-methylideneheptan-1-amine.
| Compound Name | 4,6-dimethyl-5-methylideneheptan-1-amine |
|---|---|
| PubChem CID | 135230946 |
| Molecular Formula | C10H21N |
| Molecular Weight | 155.28 g/mol |
| Exact Mass | 155.17 |
| IUPAC Name | 4,6-dimethyl-5-methylideneheptan-1-amine |
| SMILES | C=C(C(C)C)C(C)CCCN |
| InChI | InChI=1S/C10H21N/c1-8(2)10(4)9(3)6-5-7-11/h8-9H,4-7,11H2,1-3H3 |
| InChIKey | XFBJDHDSUURVBD-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|