C11H24N2 — CID 174330034
5-methyl-4-methylidenenonane-1,9-diamine (PubChem CID 174330034) has the molecular formula C11H24N2 and a molecular weight of 184.33 g/mol. Its IUPAC name is 5-methyl-4-methylidenenonane-1,9-diamine.
| Compound Name | 5-methyl-4-methylidenenonane-1,9-diamine |
|---|---|
| PubChem CID | 174330034 |
| Molecular Formula | C11H24N2 |
| Molecular Weight | 184.33 g/mol |
| Exact Mass | 184.19 |
| IUPAC Name | 5-methyl-4-methylidenenonane-1,9-diamine |
| SMILES | C=C(CCCN)C(C)CCCCN |
| InChI | InChI=1S/C11H24N2/c1-10(6-3-4-8-12)11(2)7-5-9-13/h10H,2-9,12-13H2,1H3 |
| InChIKey | OFAFHNKMLAFJBX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|