C9H19NO — CID 116613359
7-amino-2,4-dimethylheptan-3-one (PubChem CID 116613359) has the molecular formula C9H19NO and a molecular weight of 157.26 g/mol. Its IUPAC name is 7-amino-2,4-dimethylheptan-3-one.
| Compound Name | 7-amino-2,4-dimethylheptan-3-one |
|---|---|
| PubChem CID | 116613359 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 7-amino-2,4-dimethylheptan-3-one |
| SMILES | CC(C)C(=O)C(C)CCCN |
| InChI | InChI=1S/C9H19NO/c1-7(2)9(11)8(3)5-4-6-10/h7-8H,4-6,10H2,1-3H3 |
| InChIKey | KLATXUHJLRVWAT-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |