C8H18N2O — CID 134525204
5-amino-N-ethyl-2-methylpentanamide (PubChem CID 134525204) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is 5-amino-N-ethyl-2-methylpentanamide.
| Compound Name | 5-amino-N-ethyl-2-methylpentanamide |
|---|---|
| PubChem CID | 134525204 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 5-amino-N-ethyl-2-methylpentanamide |
| SMILES | CCNC(=O)C(C)CCCN |
| InChI | InChI=1S/C8H18N2O/c1-3-10-8(11)7(2)5-4-6-9/h7H,3-6,9H2,1-2H3,(H,10,11) |
| InChIKey | XSYDVIDJVBRYBQ-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |