C48H64O4Si4 — CID 67266291
2,4,6,8-tetrakis[3-(4-ethenylphenyl)propyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 67266291) has the molecular formula C48H64O4Si4 and a molecular weight of 817.38 g/mol. Its IUPAC name is 2,4,6,8-tetrakis[3-(4-ethenylphenyl)propyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetrakis[3-(4-ethenylphenyl)propyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 67266291 |
| Molecular Formula | C48H64O4Si4 |
| Molecular Weight | 817.38 g/mol |
| Exact Mass | 816.39 |
| IUPAC Name | 2,4,6,8-tetrakis[3-(4-ethenylphenyl)propyl]-2,4,6,8-tetramethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | C=Cc1ccc(CCC[Si]2(C)O[Si](C)(CCCc3ccc(C=C)cc3)O[Si](C)(CCCc3ccc(C=C)cc3)O[Si](C)(CCCc3ccc(C=C)cc3)O2)cc1 |
| InChI | InChI=1S/C48H64O4Si4/c1-9-41-21-29-45(30-22-41)17-13-37-53(5)49-54(6,38-14-18-46-31-23-42(10-2)24-32-46)51-56(8,40-16-20-48-35-27-44(12-4)28-36-48)52-55(7,50-53)39-15-19-47-33-25-43(11-3)26-34-47/h9-12,21-36H,1-4,13-20,37-40H2,5-8H3 |
| InChIKey | WJZDWFLXVDBYDY-UHFFFAOYSA-N |
| XLogP | 13.46 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 817.38 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|