C12H15NaO3S — CID 132599727
sodium 4-(4-ethenylphenyl)butane-1-sulfonate (PubChem CID 132599727) has the molecular formula C12H15NaO3S and a molecular weight of 262.31 g/mol. Its IUPAC name is sodium 4-(4-ethenylphenyl)butane-1-sulfonate.
| Compound Name | sodium 4-(4-ethenylphenyl)butane-1-sulfonate |
|---|---|
| PubChem CID | 132599727 |
| Molecular Formula | C12H15NaO3S |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | sodium 4-(4-ethenylphenyl)butane-1-sulfonate |
| SMILES | C=Cc1ccc(CCCCS(=O)(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C12H16O3S.Na/c1-2-11-6-8-12(9-7-11)5-3-4-10-16(13,14)15;/h2,6-9H,1,3-5,10H2,(H,13,14,15);/q;+1/p-1 |
| InChIKey | RDSCAQORDMNUOD-UHFFFAOYSA-M |
| XLogP | -0.80 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|