C14H21NO3S — CID 12047776
3-[(4-ethenylphenyl)methyl-dimethylazaniumyl]propane-1-sulfonate (PubChem CID 12047776) has the molecular formula C14H21NO3S and a molecular weight of 283.39 g/mol. Its IUPAC name is 3-[(4-ethenylphenyl)methyl-dimethylazaniumyl]propane-1-sulfonate.
| Compound Name | 3-[(4-ethenylphenyl)methyl-dimethylazaniumyl]propane-1-sulfonate |
|---|---|
| PubChem CID | 12047776 |
| Molecular Formula | C14H21NO3S |
| Molecular Weight | 283.39 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-[(4-ethenylphenyl)methyl-dimethylazaniumyl]propane-1-sulfonate |
| SMILES | C=Cc1ccc(C[N+](C)(C)CCCS(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C14H21NO3S/c1-4-13-6-8-14(9-7-13)12-15(2,3)10-5-11-19(16,17)18/h4,6-9H,1,5,10-12H2,2-3H3 |
| InChIKey | KWTGXHDPIPNNHP-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.39 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|