C11H13LiO3S — CID 58983822
lithium 3-(4-ethenylphenyl)propane-1-sulfonate (PubChem CID 58983822) has the molecular formula C11H13LiO3S and a molecular weight of 232.23 g/mol. Its IUPAC name is lithium 3-(4-ethenylphenyl)propane-1-sulfonate.
| Compound Name | lithium 3-(4-ethenylphenyl)propane-1-sulfonate |
|---|---|
| PubChem CID | 58983822 |
| Molecular Formula | C11H13LiO3S |
| Molecular Weight | 232.23 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | lithium 3-(4-ethenylphenyl)propane-1-sulfonate |
| SMILES | C=Cc1ccc(CCCS(=O)(=O)[O-])cc1.[Li+] |
| InChI | InChI=1S/C11H14O3S.Li/c1-2-10-5-7-11(8-6-10)4-3-9-15(12,13)14;/h2,5-8H,1,3-4,9H2,(H,12,13,14);/q;+1/p-1 |
| InChIKey | QQQMXTZTQVNLFJ-UHFFFAOYSA-M |
| XLogP | -1.19 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.23 |
| LogP ≤ 5 | -1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|