C11H34O5Si6 — CID 123791226
ethyl-[2-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]-silyloxysilane (PubChem CID 123791226) has the molecular formula C11H34O5Si6 and a molecular weight of 414.90 g/mol. Its IUPAC name is ethyl-[2-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]-silyloxysilane.
| Compound Name | ethyl-[2-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]-silyloxysilane |
|---|---|
| PubChem CID | 123791226 |
| Molecular Formula | C11H34O5Si6 |
| Molecular Weight | 414.90 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | ethyl-[2-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]-silyloxysilane |
| SMILES | CC[SiH](CC[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1)O[SiH3] |
| InChI | InChI=1S/C11H34O5Si6/c1-9-18(12-17)10-11-22(8)15-20(4,5)13-19(2,3)14-21(6,7)16-22/h18H,9-11H2,1-8,17H3 |
| InChIKey | ALVMMIBZEZXWMM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.90 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|