C31H86O13Si14 — CID 19013181
tris[2-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]-[2-[hydroxy(dimethyl)silyl]ethyl]silane (PubChem CID 19013181) has the molecular formula C31H86O13Si14 and a molecular weight of 1060.22 g/mol. Its IUPAC name is tris[2-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]-[2-[hydroxy(dimethyl)silyl]ethyl]silane.
| Compound Name | tris[2-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]-[2-[hydroxy(dimethyl)silyl]ethyl]silane |
|---|---|
| PubChem CID | 19013181 |
| Molecular Formula | C31H86O13Si14 |
| Molecular Weight | 1060.22 g/mol |
| Exact Mass | 1058.28 |
| IUPAC Name | tris[2-(2,4,4,6,6,8,8-heptamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl)ethyl]-[2-[hydroxy(dimethyl)silyl]ethyl]silane |
| SMILES | C[Si](C)(O)CC[Si](CC[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1)(CC[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1)CC[Si]1(C)O[Si](C)(C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C31H86O13Si14/c1-45(2,32)24-28-58(29-25-55(21)39-49(9,10)33-46(3,4)34-50(11,12)40-55,30-26-56(22)41-51(13,14)35-47(5,6)36-52(15,16)42-56)31-27-57(23)43-53(17,18)37-48(7,8)38-54(19,20)44-57/h32H,24-31H2,1-23H3 |
| InChIKey | RGLHYSSVYWVSHU-UHFFFAOYSA-N |
| XLogP | 10.40 |
| TPSA | 130.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1060.22 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|