C13H34O4Si4 — CID 157379219
2-butyl-8-ethyl-2,4,4,6,6,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilonane (PubChem CID 157379219) has the molecular formula C13H34O4Si4 and a molecular weight of 366.76 g/mol. Its IUPAC name is 2-butyl-8-ethyl-2,4,4,6,6,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilonane.
| Compound Name | 2-butyl-8-ethyl-2,4,4,6,6,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilonane |
|---|---|
| PubChem CID | 157379219 |
| Molecular Formula | C13H34O4Si4 |
| Molecular Weight | 366.76 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | 2-butyl-8-ethyl-2,4,4,6,6,8-hexamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilonane |
| SMILES | CCCC[Si]1(C)OC[Si](C)(CC)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C13H34O4Si4/c1-9-11-12-21(8)14-13-20(7,10-2)16-18(3,4)15-19(5,6)17-21/h9-13H2,1-8H3 |
| InChIKey | GVGXNLYGGCCBQK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.76 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|