C10H26O2Si3 — CID 59120154
4-butyl-2,2,4,6,6-pentamethyl-1,3,2,4,6-dioxatrisilinane (PubChem CID 59120154) has the molecular formula C10H26O2Si3 and a molecular weight of 262.57 g/mol. Its IUPAC name is 4-butyl-2,2,4,6,6-pentamethyl-1,3,2,4,6-dioxatrisilinane.
| Compound Name | 4-butyl-2,2,4,6,6-pentamethyl-1,3,2,4,6-dioxatrisilinane |
|---|---|
| PubChem CID | 59120154 |
| Molecular Formula | C10H26O2Si3 |
| Molecular Weight | 262.57 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | 4-butyl-2,2,4,6,6-pentamethyl-1,3,2,4,6-dioxatrisilinane |
| SMILES | CCCC[Si]1(C)C[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C10H26O2Si3/c1-7-8-9-15(6)10-13(2,3)11-14(4,5)12-15/h7-10H2,1-6H3 |
| InChIKey | PZOKUOYWMTVYOM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.57 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|