About 1,3-dibutyl-1,3-dichloro-1,3-disiletane
1,3-dibutyl-1,3-dichloro-1,3-disiletane (PubChem CID 163405863) has the molecular formula C10H22Cl2Si2
and a molecular weight of 269.36 g/mol. Its IUPAC name is 1,3-dibutyl-1,3-dichloro-1,3-disiletane.
Molecular Properties
| Compound Name | 1,3-dibutyl-1,3-dichloro-1,3-disiletane |
| PubChem CID | 163405863 |
| Molecular Formula | C10H22Cl2Si2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1,3-dibutyl-1,3-dichloro-1,3-disiletane |
| SMILES | CCCC[Si]1(Cl)C[Si](Cl)(CCCC)C1 |
| InChI | InChI=1S/C10H22Cl2Si2/c1-3-5-7-13(11)9-14(12,10-13)8-6-4-2/h3-10H2,1-2H3 |
| InChIKey | CWYXPQRLSUVFPV-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dibutyl-1,3-dichloro-1,3-disiletane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibutyl-1,3-dichloro-1,3-disiletane?
The IUPAC name of 1,3-dibutyl-1,3-dichloro-1,3-disiletane (CID 163405863) is 1,3-dibutyl-1,3-dichloro-1,3-disiletane.
What is the SMILES notation for 1,3-dibutyl-1,3-dichloro-1,3-disiletane?
The canonical SMILES for 1,3-dibutyl-1,3-dichloro-1,3-disiletane is CCCC[Si]1(Cl)C[Si](Cl)(CCCC)C1.
What is the InChIKey of 1,3-dibutyl-1,3-dichloro-1,3-disiletane?
The InChIKey is CWYXPQRLSUVFPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22Cl2Si2/c1-3-5-7-13(11)9-14(12,10-13)8-6-4-2/h3-10H2,1-2H3.
What are the key properties of 1,3-dibutyl-1,3-dichloro-1,3-disiletane?
1,3-dibutyl-1,3-dichloro-1,3-disiletane has a molecular weight of 269.36 g/mol, XLogP of 5.05, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibutyl-1,3-dichloro-1,3-disiletane is sourced from PubChem (CID 163405863), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).