C10H22Cl2Si2 — CID 163405820
1,1-dichloro-3,3-dipropyl-1,3-disilinane (PubChem CID 163405820) has the molecular formula C10H22Cl2Si2 and a molecular weight of 269.36 g/mol. Its IUPAC name is 1,1-dichloro-3,3-dipropyl-1,3-disilinane.
| Compound Name | 1,1-dichloro-3,3-dipropyl-1,3-disilinane |
|---|---|
| PubChem CID | 163405820 |
| Molecular Formula | C10H22Cl2Si2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1,1-dichloro-3,3-dipropyl-1,3-disilinane |
| SMILES | CCC[Si]1(CCC)CCC[Si](Cl)(Cl)C1 |
| InChI | InChI=1S/C10H22Cl2Si2/c1-3-6-13(7-4-2)8-5-9-14(11,12)10-13/h3-10H2,1-2H3 |
| InChIKey | SCFLLESJRMQHFW-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|