C10H23ClSi2 — CID 172685707
1-chloro-1,3-dipropyl-1,3-disilinane (PubChem CID 172685707) has the molecular formula C10H23ClSi2 and a molecular weight of 234.92 g/mol. Its IUPAC name is 1-chloro-1,3-dipropyl-1,3-disilinane.
| Compound Name | 1-chloro-1,3-dipropyl-1,3-disilinane |
|---|---|
| PubChem CID | 172685707 |
| Molecular Formula | C10H23ClSi2 |
| Molecular Weight | 234.92 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 1-chloro-1,3-dipropyl-1,3-disilinane |
| SMILES | CCC[SiH]1CCC[Si](Cl)(CCC)C1 |
| InChI | InChI=1S/C10H23ClSi2/c1-3-6-12-7-5-9-13(11,10-12)8-4-2/h12H,3-10H2,1-2H3 |
| InChIKey | AZVHDBOEJBGQFX-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.92 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|