About CID 163405851
CID 163405851 (PubChem CID 163405851) has the molecular formula C6H13Cl2Si2
and a molecular weight of 212.25 g/mol.
Molecular Properties
| Compound Name | CID 163405851 |
| PubChem CID | 163405851 |
| Molecular Formula | C6H13Cl2Si2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 210.99 |
| IUPAC Name | — |
| SMILES | CCCC[Si]1(Cl)C[Si](Cl)C1 |
| InChI | InChI=1S/C6H13Cl2Si2/c1-2-3-4-10(8)5-9(7)6-10/h2-6H2,1H3 |
| InChIKey | MLZHKKKFHDNBNV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 163405851 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 163405851?
The IUPAC name of CID 163405851 (CID 163405851) is not available.
What is the SMILES notation for CID 163405851?
The canonical SMILES for CID 163405851 is CCCC[Si]1(Cl)C[Si](Cl)C1.
What is the InChIKey of CID 163405851?
The InChIKey is MLZHKKKFHDNBNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13Cl2Si2/c1-2-3-4-10(8)5-9(7)6-10/h2-6H2,1H3.
What are the key properties of CID 163405851?
CID 163405851 has a molecular weight of 212.25 g/mol, XLogP of 3.29, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 163405851 is sourced from PubChem (CID 163405851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).