C40H90Si5 — CID 12561632
1,1,2,2,3,3,4,4,5,5-decabutylpentasilolane (PubChem CID 12561632) has the molecular formula C40H90Si5 and a molecular weight of 711.59 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,5,5-decabutylpentasilolane.
| Compound Name | 1,1,2,2,3,3,4,4,5,5-decabutylpentasilolane |
|---|---|
| PubChem CID | 12561632 |
| Molecular Formula | C40H90Si5 |
| Molecular Weight | 711.59 g/mol |
| Exact Mass | 710.59 |
| IUPAC Name | 1,1,2,2,3,3,4,4,5,5-decabutylpentasilolane |
| SMILES | CCCC[Si]1(CCCC)[Si](CCCC)(CCCC)[Si](CCCC)(CCCC)[Si](CCCC)(CCCC)[Si]1(CCCC)CCCC |
| InChI | InChI=1S/C40H90Si5/c1-11-21-31-41(32-22-12-2)42(33-23-13-3,34-24-14-4)44(37-27-17-7,38-28-18-8)45(39-29-19-9,40-30-20-10)43(41,35-25-15-5)36-26-16-6/h11-40H2,1-10H3 |
| InChIKey | AVIMDXQQJUFCRV-UHFFFAOYSA-N |
| XLogP | 15.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.59 |
| LogP ≤ 5 | 15.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|