C8H19BrSi2 — CID 172831370
1-bromo-4-butyl-1,4-disilinane (PubChem CID 172831370) has the molecular formula C8H19BrSi2 and a molecular weight of 251.32 g/mol. Its IUPAC name is 1-bromo-4-butyl-1,4-disilinane.
| Compound Name | 1-bromo-4-butyl-1,4-disilinane |
|---|---|
| PubChem CID | 172831370 |
| Molecular Formula | C8H19BrSi2 |
| Molecular Weight | 251.32 g/mol |
| Exact Mass | 250.02 |
| IUPAC Name | 1-bromo-4-butyl-1,4-disilinane |
| SMILES | CCCC[SiH]1CC[SiH](Br)CC1 |
| InChI | InChI=1S/C8H19BrSi2/c1-2-3-4-10-5-7-11(9)8-6-10/h10-11H,2-8H2,1H3 |
| InChIKey | VODBTGBUSBXUMO-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|