C12H28Br2Cl2Si4 — CID 175447904
3-butyl-1,1-dichloro-1,3-disiletane;1,2-dibromo-3-butyl-1,3-disiletane (PubChem CID 175447904) has the molecular formula C12H28Br2Cl2Si4 and a molecular weight of 515.41 g/mol. Its IUPAC name is 3-butyl-1,1-dichloro-1,3-disiletane;1,2-dibromo-3-butyl-1,3-disiletane.
| Compound Name | 3-butyl-1,1-dichloro-1,3-disiletane;1,2-dibromo-3-butyl-1,3-disiletane |
|---|---|
| PubChem CID | 175447904 |
| Molecular Formula | C12H28Br2Cl2Si4 |
| Molecular Weight | 515.41 g/mol |
| Exact Mass | 511.90 |
| IUPAC Name | 3-butyl-1,1-dichloro-1,3-disiletane;1,2-dibromo-3-butyl-1,3-disiletane |
| SMILES | CCCC[SiH]1C[SiH](Br)C1Br.CCCC[SiH]1C[Si](Cl)(Cl)C1 |
| InChI | InChI=1S/C6H14Br2Si2.C6H14Cl2Si2/c1-2-3-4-9-5-10(8)6(9)7;1-2-3-4-9-5-10(7,8)6-9/h6,9-10H,2-5H2,1H3;9H,2-6H2,1H3 |
| InChIKey | CRWICPHFVFAEKS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.41 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|