About 2-(oxiran-2-ylmethoxymethyl)oxirane;2-propyloxasilinane
2-(oxiran-2-ylmethoxymethyl)oxirane;2-propyloxasilinane (PubChem CID 175335046) has the molecular formula C13H26O4Si
and a molecular weight of 274.43 g/mol. Its IUPAC name is 2-(oxiran-2-ylmethoxymethyl)oxirane;2-propyloxasilinane.
Molecular Properties
| Compound Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;2-propyloxasilinane |
| PubChem CID | 175335046 |
| Molecular Formula | C13H26O4Si |
| Molecular Weight | 274.43 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | 2-(oxiran-2-ylmethoxymethyl)oxirane;2-propyloxasilinane |
| SMILES | C(OCC1CO1)C1CO1.CCC[SiH]1CCCCO1 |
| InChI | InChI=1S/C7H16OSi.C6H10O3/c1-2-6-9-7-4-3-5-8-9;1(5-3-8-5)7-2-6-4-9-6/h9H,2-7H2,1H3;5-6H,1-4H2 |
| InChIKey | BULNEBCTSCOPJU-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 43.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-(oxiran-2-ylmethoxymethyl)oxirane;2-propyloxasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;2-propyloxasilinane?
The IUPAC name of 2-(oxiran-2-ylmethoxymethyl)oxirane;2-propyloxasilinane (CID 175335046) is 2-(oxiran-2-ylmethoxymethyl)oxirane;2-propyloxasilinane.
What is the SMILES notation for 2-(oxiran-2-ylmethoxymethyl)oxirane;2-propyloxasilinane?
The canonical SMILES for 2-(oxiran-2-ylmethoxymethyl)oxirane;2-propyloxasilinane is C(OCC1CO1)C1CO1.CCC[SiH]1CCCCO1.
What is the InChIKey of 2-(oxiran-2-ylmethoxymethyl)oxirane;2-propyloxasilinane?
The InChIKey is BULNEBCTSCOPJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16OSi.C6H10O3/c1-2-6-9-7-4-3-5-8-9;1(5-3-8-5)7-2-6-4-9-6/h9H,2-7H2,1H3;5-6H,1-4H2.
What are the key properties of 2-(oxiran-2-ylmethoxymethyl)oxirane;2-propyloxasilinane?
2-(oxiran-2-ylmethoxymethyl)oxirane;2-propyloxasilinane has a molecular weight of 274.43 g/mol, XLogP of 1.73, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(oxiran-2-ylmethoxymethyl)oxirane;2-propyloxasilinane is sourced from PubChem (CID 175335046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).