C17H37NOSi — CID 174686072
1,2,2,6,6-pentamethylpiperidine;2-propyloxasilinane (PubChem CID 174686072) has the molecular formula C17H37NOSi and a molecular weight of 299.58 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethylpiperidine;2-propyloxasilinane.
| Compound Name | 1,2,2,6,6-pentamethylpiperidine;2-propyloxasilinane |
|---|---|
| PubChem CID | 174686072 |
| Molecular Formula | C17H37NOSi |
| Molecular Weight | 299.58 g/mol |
| Exact Mass | 299.26 |
| IUPAC Name | 1,2,2,6,6-pentamethylpiperidine;2-propyloxasilinane |
| SMILES | CCC[SiH]1CCCCO1.CN1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C10H21N.C7H16OSi/c1-9(2)7-6-8-10(3,4)11(9)5;1-2-6-9-7-4-3-5-8-9/h6-8H2,1-5H3;9H,2-7H2,1H3 |
| InChIKey | QFWWKEAEIJWDHT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|