C20H41N — CID 165011637
1,2,2,6,6-pentamethylpiperidine;1,1,3,3-tetramethylcyclohexane (PubChem CID 165011637) has the molecular formula C20H41N and a molecular weight of 295.56 g/mol. Its IUPAC name is 1,2,2,6,6-pentamethylpiperidine;1,1,3,3-tetramethylcyclohexane.
| Compound Name | 1,2,2,6,6-pentamethylpiperidine;1,1,3,3-tetramethylcyclohexane |
|---|---|
| PubChem CID | 165011637 |
| Molecular Formula | C20H41N |
| Molecular Weight | 295.56 g/mol |
| Exact Mass | 295.32 |
| IUPAC Name | 1,2,2,6,6-pentamethylpiperidine;1,1,3,3-tetramethylcyclohexane |
| SMILES | CC1(C)CCCC(C)(C)C1.CN1C(C)(C)CCCC1(C)C |
| InChI | InChI=1S/C10H21N.C10H20/c1-9(2)7-6-8-10(3,4)11(9)5;1-9(2)6-5-7-10(3,4)8-9/h6-8H2,1-5H3;5-8H2,1-4H3 |
| InChIKey | JUIVGMPJFDPCJE-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.56 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |