About difluoro(hydroxy)silane;6-fluoro-2-methyl-2-propyloxasilinane
difluoro(hydroxy)silane;6-fluoro-2-methyl-2-propyloxasilinane (PubChem CID 174571975) has the molecular formula C8H19F3O2Si2
and a molecular weight of 260.40 g/mol. Its IUPAC name is difluoro(hydroxy)silane;6-fluoro-2-methyl-2-propyloxasilinane.
Molecular Properties
| Compound Name | difluoro(hydroxy)silane;6-fluoro-2-methyl-2-propyloxasilinane |
| PubChem CID | 174571975 |
| Molecular Formula | C8H19F3O2Si2 |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | difluoro(hydroxy)silane;6-fluoro-2-methyl-2-propyloxasilinane |
| SMILES | CCC[Si]1(C)CCCC(F)O1.O[SiH](F)F |
| InChI | InChI=1S/C8H17FOSi.F2H2OSi/c1-3-6-11(2)7-4-5-8(9)10-11;1-4(2)3/h8H,3-7H2,1-2H3;3-4H |
| InChIKey | BEVBJVWAYWZKSA-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze difluoro(hydroxy)silane;6-fluoro-2-methyl-2-propyloxasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of difluoro(hydroxy)silane;6-fluoro-2-methyl-2-propyloxasilinane?
The IUPAC name of difluoro(hydroxy)silane;6-fluoro-2-methyl-2-propyloxasilinane (CID 174571975) is difluoro(hydroxy)silane;6-fluoro-2-methyl-2-propyloxasilinane.
What is the SMILES notation for difluoro(hydroxy)silane;6-fluoro-2-methyl-2-propyloxasilinane?
The canonical SMILES for difluoro(hydroxy)silane;6-fluoro-2-methyl-2-propyloxasilinane is CCC[Si]1(C)CCCC(F)O1.O[SiH](F)F.
What is the InChIKey of difluoro(hydroxy)silane;6-fluoro-2-methyl-2-propyloxasilinane?
The InChIKey is BEVBJVWAYWZKSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17FOSi.F2H2OSi/c1-3-6-11(2)7-4-5-8(9)10-11;1-4(2)3/h8H,3-7H2,1-2H3;3-4H.
What are the key properties of difluoro(hydroxy)silane;6-fluoro-2-methyl-2-propyloxasilinane?
difluoro(hydroxy)silane;6-fluoro-2-methyl-2-propyloxasilinane has a molecular weight of 260.40 g/mol, XLogP of 2.71, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for difluoro(hydroxy)silane;6-fluoro-2-methyl-2-propyloxasilinane is sourced from PubChem (CID 174571975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).