C7H15ClOSi — CID 174565435
6-(chloromethyl)-2,2-dimethyloxasilinane (PubChem CID 174565435) has the molecular formula C7H15ClOSi and a molecular weight of 178.73 g/mol. Its IUPAC name is 6-(chloromethyl)-2,2-dimethyloxasilinane.
| Compound Name | 6-(chloromethyl)-2,2-dimethyloxasilinane |
|---|---|
| PubChem CID | 174565435 |
| Molecular Formula | C7H15ClOSi |
| Molecular Weight | 178.73 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 6-(chloromethyl)-2,2-dimethyloxasilinane |
| SMILES | C[Si]1(C)CCCC(CCl)O1 |
| InChI | InChI=1S/C7H15ClOSi/c1-10(2)5-3-4-7(6-8)9-10/h7H,3-6H2,1-2H3 |
| InChIKey | XONRDMBSJVXCHW-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.73 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|