C11H26N2OSi — CID 66958834
1-N'-[1-(2,2-dimethyloxasilinan-6-yl)propyl]ethane-1,1-diamine (PubChem CID 66958834) has the molecular formula C11H26N2OSi and a molecular weight of 230.43 g/mol. Its IUPAC name is 1-N'-[1-(2,2-dimethyloxasilinan-6-yl)propyl]ethane-1,1-diamine.
| Compound Name | 1-N'-[1-(2,2-dimethyloxasilinan-6-yl)propyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 66958834 |
| Molecular Formula | C11H26N2OSi |
| Molecular Weight | 230.43 g/mol |
| Exact Mass | 230.18 |
| IUPAC Name | 1-N'-[1-(2,2-dimethyloxasilinan-6-yl)propyl]ethane-1,1-diamine |
| SMILES | CCC(NC(C)N)C1CCC[Si](C)(C)O1 |
| InChI | InChI=1S/C11H26N2OSi/c1-5-10(13-9(2)12)11-7-6-8-15(3,4)14-11/h9-11,13H,5-8,12H2,1-4H3 |
| InChIKey | VPFZZJQQBJDWGR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|