C12H30N2O5Si2 — CID 174976255
1-N'-[1-(2,2,3,3-tetramethoxyoxadisilinan-6-yl)propyl]ethane-1,1-diamine (PubChem CID 174976255) has the molecular formula C12H30N2O5Si2 and a molecular weight of 338.55 g/mol. Its IUPAC name is 1-N'-[1-(2,2,3,3-tetramethoxyoxadisilinan-6-yl)propyl]ethane-1,1-diamine.
| Compound Name | 1-N'-[1-(2,2,3,3-tetramethoxyoxadisilinan-6-yl)propyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 174976255 |
| Molecular Formula | C12H30N2O5Si2 |
| Molecular Weight | 338.55 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-N'-[1-(2,2,3,3-tetramethoxyoxadisilinan-6-yl)propyl]ethane-1,1-diamine |
| SMILES | CCC(NC(C)N)C1CC[Si](OC)(OC)[Si](OC)(OC)O1 |
| InChI | InChI=1S/C12H30N2O5Si2/c1-7-11(14-10(2)13)12-8-9-20(15-3,16-4)21(17-5,18-6)19-12/h10-12,14H,7-9,13H2,1-6H3 |
| InChIKey | RGODOLGKVFUWQO-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 84.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.55 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|