C30H58O9Si2 — CID 58675298
2-[2-[3-(2,9-dimethyloxasilonan-2-yl)propoxycarbonyloxy]ethoxy]ethyl 3-(2,9-dimethyloxasilonan-2-yl)propyl carbonate (PubChem CID 58675298) has the molecular formula C30H58O9Si2 and a molecular weight of 618.96 g/mol. Its IUPAC name is 2-[2-[3-(2,9-dimethyloxasilonan-2-yl)propoxycarbonyloxy]ethoxy]ethyl 3-(2,9-dimethyloxasilonan-2-yl)propyl carbonate.
| Compound Name | 2-[2-[3-(2,9-dimethyloxasilonan-2-yl)propoxycarbonyloxy]ethoxy]ethyl 3-(2,9-dimethyloxasilonan-2-yl)propyl carbonate |
|---|---|
| PubChem CID | 58675298 |
| Molecular Formula | C30H58O9Si2 |
| Molecular Weight | 618.96 g/mol |
| Exact Mass | 618.36 |
| IUPAC Name | 2-[2-[3-(2,9-dimethyloxasilonan-2-yl)propoxycarbonyloxy]ethoxy]ethyl 3-(2,9-dimethyloxasilonan-2-yl)propyl carbonate |
| SMILES | CC1CCCCCC[Si](C)(CCCOC(=O)OCCOCCOC(=O)OCCC[Si]2(C)CCCCCCC(C)O2)O1 |
| InChI | InChI=1S/C30H58O9Si2/c1-27-15-9-5-7-11-23-40(3,38-27)25-13-17-34-29(31)36-21-19-33-20-22-37-30(32)35-18-14-26-41(4)24-12-8-6-10-16-28(2)39-41/h27-28H,5-26H2,1-4H3 |
| InChIKey | WAPIENSPESXZPH-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.96 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|