C13H29BrSi2 — CID 163405800
1-bromo-1,3,3-tripropyl-1,3-disilinane (PubChem CID 163405800) has the molecular formula C13H29BrSi2 and a molecular weight of 321.45 g/mol. Its IUPAC name is 1-bromo-1,3,3-tripropyl-1,3-disilinane.
| Compound Name | 1-bromo-1,3,3-tripropyl-1,3-disilinane |
|---|---|
| PubChem CID | 163405800 |
| Molecular Formula | C13H29BrSi2 |
| Molecular Weight | 321.45 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 1-bromo-1,3,3-tripropyl-1,3-disilinane |
| SMILES | CCC[Si]1(Br)CCC[Si](CCC)(CCC)C1 |
| InChI | InChI=1S/C13H29BrSi2/c1-4-8-15(9-5-2)11-7-12-16(14,13-15)10-6-3/h4-13H2,1-3H3 |
| InChIKey | RFSCCEKTJOSRMR-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|