C10H24OSi — CID 175060345
butane;2,2-dimethyloxasilinane (PubChem CID 175060345) has the molecular formula C10H24OSi and a molecular weight of 188.39 g/mol. Its IUPAC name is butane;2,2-dimethyloxasilinane.
| Compound Name | butane;2,2-dimethyloxasilinane |
|---|---|
| PubChem CID | 175060345 |
| Molecular Formula | C10H24OSi |
| Molecular Weight | 188.39 g/mol |
| Exact Mass | 188.16 |
| IUPAC Name | butane;2,2-dimethyloxasilinane |
| SMILES | CCCC.C[Si]1(C)CCCCO1 |
| InChI | InChI=1S/C6H14OSi.C4H10/c1-8(2)6-4-3-5-7-8;1-3-4-2/h3-6H2,1-2H3;3-4H2,1-2H3 |
| InChIKey | ODIIUEYIRBYXKD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.39 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|