C8H20O2Si2 — CID 12619896
2,2,6,6-tetramethyl-1,5,2,6-dioxadisilocane (PubChem CID 12619896) has the molecular formula C8H20O2Si2 and a molecular weight of 204.42 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-1,5,2,6-dioxadisilocane.
| Compound Name | 2,2,6,6-tetramethyl-1,5,2,6-dioxadisilocane |
|---|---|
| PubChem CID | 12619896 |
| Molecular Formula | C8H20O2Si2 |
| Molecular Weight | 204.42 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2,2,6,6-tetramethyl-1,5,2,6-dioxadisilocane |
| SMILES | C[Si]1(C)CCO[Si](C)(C)CCO1 |
| InChI | InChI=1S/C8H20O2Si2/c1-11(2)7-5-10-12(3,4)8-6-9-11/h5-8H2,1-4H3 |
| InChIKey | CXIDLVULPZKMMG-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|