C10H26O3Si3 — CID 59872704
2,2,4,4,10,10-hexamethyl-1,3,7,2,4,10-trioxatrisilecane (PubChem CID 59872704) has the molecular formula C10H26O3Si3 and a molecular weight of 278.57 g/mol. Its IUPAC name is 2,2,4,4,10,10-hexamethyl-1,3,7,2,4,10-trioxatrisilecane.
| Compound Name | 2,2,4,4,10,10-hexamethyl-1,3,7,2,4,10-trioxatrisilecane |
|---|---|
| PubChem CID | 59872704 |
| Molecular Formula | C10H26O3Si3 |
| Molecular Weight | 278.57 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 2,2,4,4,10,10-hexamethyl-1,3,7,2,4,10-trioxatrisilecane |
| SMILES | C[Si]1(C)CCOCC[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C10H26O3Si3/c1-14(2)9-7-11-8-10-15(3,4)13-16(5,6)12-14/h7-10H2,1-6H3 |
| InChIKey | ZCHOXWZMZGCOSE-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.57 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|