C14H30O4Si4 — CID 132514076
19,19-dimethyl-6,12,18,20-tetraoxa-5,7,13,19-tetrasilatrispiro[4.1.47.1.413.35]icosane (PubChem CID 132514076) has the molecular formula C14H30O4Si4 and a molecular weight of 374.73 g/mol. Its IUPAC name is 19,19-dimethyl-6,12,18,20-tetraoxa-5,7,13,19-tetrasilatrispiro[4.1.47.1.413.35]icosane.
| Compound Name | 19,19-dimethyl-6,12,18,20-tetraoxa-5,7,13,19-tetrasilatrispiro[4.1.47.1.413.35]icosane |
|---|---|
| PubChem CID | 132514076 |
| Molecular Formula | C14H30O4Si4 |
| Molecular Weight | 374.73 g/mol |
| Exact Mass | 374.12 |
| IUPAC Name | 19,19-dimethyl-6,12,18,20-tetraoxa-5,7,13,19-tetrasilatrispiro[4.1.47.1.413.35]icosane |
| SMILES | C[Si]1(C)O[Si]2(CCCC2)O[Si]2(CCCC2)O[Si]2(CCCC2)O1 |
| InChI | InChI=1S/C14H30O4Si4/c1-19(2)15-20(9-3-4-10-20)17-22(13-7-8-14-22)18-21(16-19)11-5-6-12-21/h3-14H2,1-2H3 |
| InChIKey | YSPDJAFSCOIEJJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.73 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|