C14H30Si2 — CID 101130217
1,6-dimethyl-1,6-disilabicyclo[4.4.4]tetradecane (PubChem CID 101130217) has the molecular formula C14H30Si2 and a molecular weight of 254.57 g/mol. Its IUPAC name is 1,6-dimethyl-1,6-disilabicyclo[4.4.4]tetradecane.
| Compound Name | 1,6-dimethyl-1,6-disilabicyclo[4.4.4]tetradecane |
|---|---|
| PubChem CID | 101130217 |
| Molecular Formula | C14H30Si2 |
| Molecular Weight | 254.57 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | 1,6-dimethyl-1,6-disilabicyclo[4.4.4]tetradecane |
| SMILES | C[Si]12CCCC[Si](C)(CCCC1)CCCC2 |
| InChI | InChI=1S/C14H30Si2/c1-15-9-3-6-12-16(2,13-7-4-10-15)14-8-5-11-15/h3-14H2,1-2H3 |
| InChIKey | PCJZHRJDIARITI-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.57 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|