C32H66Si2 — CID 177476955
1,12-dimethyl-1,12-disilabicyclo[10.10.10]dotriacontane (PubChem CID 177476955) has the molecular formula C32H66Si2 and a molecular weight of 507.05 g/mol. Its IUPAC name is 1,12-dimethyl-1,12-disilabicyclo[10.10.10]dotriacontane.
| Compound Name | 1,12-dimethyl-1,12-disilabicyclo[10.10.10]dotriacontane |
|---|---|
| PubChem CID | 177476955 |
| Molecular Formula | C32H66Si2 |
| Molecular Weight | 507.05 g/mol |
| Exact Mass | 506.47 |
| IUPAC Name | 1,12-dimethyl-1,12-disilabicyclo[10.10.10]dotriacontane |
| SMILES | C[Si]12CCCCCCCCCC[Si](C)(CCCCCCCCCC1)CCCCCCCCCC2 |
| InChI | InChI=1S/C32H66Si2/c1-33-27-21-15-9-3-6-12-18-24-30-34(2,31-25-19-13-7-4-10-16-22-28-33)32-26-20-14-8-5-11-17-23-29-33/h3-32H2,1-2H3 |
| InChIKey | SFDDQWFWEVPETR-UHFFFAOYSA-N |
| XLogP | 12.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.05 |
| LogP ≤ 5 | 12.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|