C16H36Si2 — CID 177413493
1,1,8,8-tetramethyl-1,8-disilacyclotetradecane (PubChem CID 177413493) has the molecular formula C16H36Si2 and a molecular weight of 284.64 g/mol. Its IUPAC name is 1,1,8,8-tetramethyl-1,8-disilacyclotetradecane.
| Compound Name | 1,1,8,8-tetramethyl-1,8-disilacyclotetradecane |
|---|---|
| PubChem CID | 177413493 |
| Molecular Formula | C16H36Si2 |
| Molecular Weight | 284.64 g/mol |
| Exact Mass | 284.24 |
| IUPAC Name | 1,1,8,8-tetramethyl-1,8-disilacyclotetradecane |
| SMILES | C[Si]1(C)CCCCCC[Si](C)(C)CCCCCC1 |
| InChI | InChI=1S/C16H36Si2/c1-17(2)13-9-5-7-11-15-18(3,4)16-12-8-6-10-14-17/h5-16H2,1-4H3 |
| InChIKey | SMHJBHJJTGXDNS-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.64 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|