C7H17NSi — CID 54576757
4,4-dimethyl-1,4-azasilepane (PubChem CID 54576757) has the molecular formula C7H17NSi and a molecular weight of 143.31 g/mol. Its IUPAC name is 4,4-dimethyl-1,4-azasilepane.
| Compound Name | 4,4-dimethyl-1,4-azasilepane |
|---|---|
| PubChem CID | 54576757 |
| Molecular Formula | C7H17NSi |
| Molecular Weight | 143.31 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | 4,4-dimethyl-1,4-azasilepane |
| SMILES | C[Si]1(C)CCCNCC1 |
| InChI | InChI=1S/C7H17NSi/c1-9(2)6-3-4-8-5-7-9/h8H,3-7H2,1-2H3 |
| InChIKey | KWEOZTVWBFWMKC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.31 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|