C8H18Si — CID 21335072
1,1-dimethylsilepane (PubChem CID 21335072) has the molecular formula C8H18Si and a molecular weight of 142.32 g/mol. Its IUPAC name is 1,1-dimethylsilepane.
| Compound Name | 1,1-dimethylsilepane |
|---|---|
| PubChem CID | 21335072 |
| Molecular Formula | C8H18Si |
| Molecular Weight | 142.32 g/mol |
| Exact Mass | 142.12 |
| IUPAC Name | 1,1-dimethylsilepane |
| SMILES | C[Si]1(C)CCCCCC1 |
| InChI | InChI=1S/C8H18Si/c1-9(2)7-5-3-4-6-8-9/h3-8H2,1-2H3 |
| InChIKey | ACCILMOFBCODON-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|